C17H24N2O4 — CID 54597488
(3S,6S)-3-benzyl-3,6-dimethoxy-6-(2-methylpropyl)piperazine-2,5-dione (PubChem CID 54597488) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is (3S,6S)-3-benzyl-3,6-dimethoxy-6-(2-methylpropyl)piperazine-2,5-dione.
| Compound Name | (3S,6S)-3-benzyl-3,6-dimethoxy-6-(2-methylpropyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 54597488 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (3S,6S)-3-benzyl-3,6-dimethoxy-6-(2-methylpropyl)piperazine-2,5-dione |
| SMILES | CO[C@]1(Cc2ccccc2)NC(=O)[C@](CC(C)C)(OC)NC1=O |
| InChI | InChI=1S/C17H24N2O4/c1-12(2)10-16(22-3)14(20)19-17(23-4,15(21)18-16)11-13-8-6-5-7-9-13/h5-9,12H,10-11H2,1-4H3,(H,18,21)(H,19,20)/t16-,17-/m0/s1 |
| InChIKey | BMACKMSINBGRRE-IRXDYDNUSA-N |
| XLogP | 1.21 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |