C25H49NO2Si — CID 54597645
[(3R,5R,7S,7aR,11aS)-7-[tert-butyl(dimethyl)silyl]oxy-5-hexyl-2,3,5,6,7,7a,8,9,10,11-decahydro-1H-pyrrolo[2,1-j]quinolin-3-yl]methanol (PubChem CID 54597645) has the molecular formula C25H49NO2Si and a molecular weight of 423.76 g/mol. Its IUPAC name is [(3R,5R,7S,7aR,11aS)-7-[tert-butyl(dimethyl)silyl]oxy-5-hexyl-2,3,5,6,7,7a,8,9,10,11-decahydro-1H-pyrrolo[2,1-j]quinolin-3-yl]methanol.
| Compound Name | [(3R,5R,7S,7aR,11aS)-7-[tert-butyl(dimethyl)silyl]oxy-5-hexyl-2,3,5,6,7,7a,8,9,10,11-decahydro-1H-pyrrolo[2,1-j]quinolin-3-yl]methanol |
|---|---|
| PubChem CID | 54597645 |
| Molecular Formula | C25H49NO2Si |
| Molecular Weight | 423.76 g/mol |
| Exact Mass | 423.35 |
| IUPAC Name | [(3R,5R,7S,7aR,11aS)-7-[tert-butyl(dimethyl)silyl]oxy-5-hexyl-2,3,5,6,7,7a,8,9,10,11-decahydro-1H-pyrrolo[2,1-j]quinolin-3-yl]methanol |
| SMILES | CCCCCC[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2CCCC[C@]23CC[C@H](CO)N13 |
| InChI | InChI=1S/C25H49NO2Si/c1-7-8-9-10-13-20-18-23(28-29(5,6)24(2,3)4)22-14-11-12-16-25(22)17-15-21(19-27)26(20)25/h20-23,27H,7-19H2,1-6H3/t20-,21-,22+,23+,25+/m1/s1 |
| InChIKey | UXHQGZUUBHJUIU-BZDYCCQFSA-N |
| XLogP | 6.51 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.76 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|