C19H23ClO5S — CID 54597681
(2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-ethylphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 54597681) has the molecular formula C19H23ClO5S and a molecular weight of 398.91 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-ethylphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-ethylphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 54597681 |
| Molecular Formula | C19H23ClO5S |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-ethylphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)sc2Cl)cc1 |
| InChI | InChI=1S/C19H23ClO5S/c1-2-10-3-5-11(6-4-10)7-12-8-14(26-19(12)20)18-17(24)16(23)15(22)13(9-21)25-18/h3-6,8,13,15-18,21-24H,2,7,9H2,1H3/t13-,15-,16+,17-,18+/m1/s1 |
| InChIKey | YPQYOSUMCMYVPK-LHKMKVQPSA-N |
| XLogP | 2.07 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |