C24H41NO4Si — CID 54598007
tert-butyl (2S,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxypiperidine-1-carboxylate (PubChem CID 54598007) has the molecular formula C24H41NO4Si and a molecular weight of 435.68 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 54598007 |
| Molecular Formula | C24H41NO4Si |
| Molecular Weight | 435.68 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | tert-butyl (2S,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](OCc2ccccc2)[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H41NO4Si/c1-23(2,3)29-22(26)25-16-12-15-21(27-17-19-13-10-9-11-14-19)20(25)18-28-30(7,8)24(4,5)6/h9-11,13-14,20-21H,12,15-18H2,1-8H3/t20-,21+/m0/s1 |
| InChIKey | AWGXTESLYRQQMG-LEWJYISDSA-N |
| XLogP | 5.99 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.68 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|