C34H30ClN6O4+ — CID 54598361
1-N,4-N-bis[4-[(1-methylpyridin-1-ium-4-yl)carbamoyl]phenyl]benzene-1,4-dicarboxamide chloride (PubChem CID 54598361) has the molecular formula C34H30ClN6O4+ and a molecular weight of 622.11 g/mol. Its IUPAC name is 1-N,4-N-bis[4-[(1-methylpyridin-1-ium-4-yl)carbamoyl]phenyl]benzene-1,4-dicarboxamide chloride.
| Compound Name | 1-N,4-N-bis[4-[(1-methylpyridin-1-ium-4-yl)carbamoyl]phenyl]benzene-1,4-dicarboxamide chloride |
|---|---|
| PubChem CID | 54598361 |
| Molecular Formula | C34H30ClN6O4+ |
| Molecular Weight | 622.11 g/mol |
| Exact Mass | 621.20 |
| IUPAC Name | 1-N,4-N-bis[4-[(1-methylpyridin-1-ium-4-yl)carbamoyl]phenyl]benzene-1,4-dicarboxamide chloride |
| SMILES | C[n+]1ccc(NC(=O)c2ccc(NC(=O)c3ccc(C(=O)Nc4ccc(C(=O)Nc5cc[n+](C)cc5)cc4)cc3)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C34H28N6O4.ClH/c1-39-19-15-29(16-20-39)37-33(43)25-7-11-27(12-8-25)35-31(41)23-3-5-24(6-4-23)32(42)36-28-13-9-26(10-14-28)34(44)38-30-17-21-40(2)22-18-30;/h3-22H,1-2H3,(H2,35,36,41,42,43,44);1H/p+1 |
| InChIKey | CNTTXUXSEMSUGI-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.11 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|