About 3,5-dioxohexanoic acid
3,5-dioxohexanoic acid (PubChem CID 5459844) has the molecular formula C6H8O4
and a molecular weight of 144.13 g/mol. Its IUPAC name is 3,5-dioxohexanoic acid.
Molecular Properties
| Compound Name | 3,5-dioxohexanoic acid |
| PubChem CID | 5459844 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 3,5-dioxohexanoic acid |
| SMILES | CC(=O)CC(=O)CC(=O)O |
| InChI | InChI=1S/C6H8O4/c1-4(7)2-5(8)3-6(9)10/h2-3H2,1H3,(H,9,10) |
| InChIKey | ILJSQTXMGCGYMG-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dioxohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dioxohexanoic acid?
The IUPAC name of 3,5-dioxohexanoic acid (CID 5459844) is 3,5-dioxohexanoic acid.
What is the SMILES notation for 3,5-dioxohexanoic acid?
The canonical SMILES for 3,5-dioxohexanoic acid is CC(=O)CC(=O)CC(=O)O.
What is the InChIKey of 3,5-dioxohexanoic acid?
The InChIKey is ILJSQTXMGCGYMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O4/c1-4(7)2-5(8)3-6(9)10/h2-3H2,1H3,(H,9,10).
What are the key properties of 3,5-dioxohexanoic acid?
3,5-dioxohexanoic acid has a molecular weight of 144.13 g/mol, XLogP of 0.01, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dioxohexanoic acid is sourced from PubChem (CID 5459844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).