C46H52BrN4O2+ — CID 54598578
2-[2-[8-[6-(2-hydroxyethyl)-5,11-dimethylpyrido[4,3-b]carbazol-2-ium-2-yl]octyl]-5,11-dimethylpyrido[4,3-b]carbazol-2-ium-6-yl]ethanol bromide (PubChem CID 54598578) has the molecular formula C46H52BrN4O2+ and a molecular weight of 772.85 g/mol. Its IUPAC name is 2-[2-[8-[6-(2-hydroxyethyl)-5,11-dimethylpyrido[4,3-b]carbazol-2-ium-2-yl]octyl]-5,11-dimethylpyrido[4,3-b]carbazol-2-ium-6-yl]ethanol bromide.
| Compound Name | 2-[2-[8-[6-(2-hydroxyethyl)-5,11-dimethylpyrido[4,3-b]carbazol-2-ium-2-yl]octyl]-5,11-dimethylpyrido[4,3-b]carbazol-2-ium-6-yl]ethanol bromide |
|---|---|
| PubChem CID | 54598578 |
| Molecular Formula | C46H52BrN4O2+ |
| Molecular Weight | 772.85 g/mol |
| Exact Mass | 771.33 |
| IUPAC Name | 2-[2-[8-[6-(2-hydroxyethyl)-5,11-dimethylpyrido[4,3-b]carbazol-2-ium-2-yl]octyl]-5,11-dimethylpyrido[4,3-b]carbazol-2-ium-6-yl]ethanol bromide |
| SMILES | Cc1c2c[n+](CCCCCCCC[n+]3ccc4c(C)c5c(c(C)c4c3)c3ccccc3n5CCO)ccc2c(C)c2c1c1ccccc1n2CCO.[Br-] |
| InChI | InChI=1S/C46H52N4O2.BrH/c1-31-39-29-47(23-19-35(39)33(3)45-43(31)37-15-9-11-17-41(37)49(45)25-27-51)21-13-7-5-6-8-14-22-48-24-20-36-34(4)46-44(32(2)40(36)30-48)38-16-10-12-18-42(38)50(46)26-28-52;/h9-12,15-20,23-24,29-30,51-52H,5-8,13-14,21-22,25-28H2,1-4H3;1H/q+2;/p-1 |
| InChIKey | KZSNDITVGADBBB-UHFFFAOYSA-M |
| XLogP | 6.05 |
| TPSA | 58.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.85 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|