C36H37Cl3N4O2 — CID 54598616
N,N'-bis(3-chloro-6-methoxyacridin-9-yl)octane-1,8-diamine;hydrochloride (PubChem CID 54598616) has the molecular formula C36H37Cl3N4O2 and a molecular weight of 664.08 g/mol. Its IUPAC name is N,N'-bis(3-chloro-6-methoxyacridin-9-yl)octane-1,8-diamine;hydrochloride.
| Compound Name | N,N'-bis(3-chloro-6-methoxyacridin-9-yl)octane-1,8-diamine;hydrochloride |
|---|---|
| PubChem CID | 54598616 |
| Molecular Formula | C36H37Cl3N4O2 |
| Molecular Weight | 664.08 g/mol |
| Exact Mass | 662.20 |
| IUPAC Name | N,N'-bis(3-chloro-6-methoxyacridin-9-yl)octane-1,8-diamine;hydrochloride |
| SMILES | COc1ccc2c(NCCCCCCCCNc3c4ccc(Cl)cc4nc4cc(OC)ccc34)c3ccc(Cl)cc3nc2c1.Cl |
| InChI | InChI=1S/C36H36Cl2N4O2.ClH/c1-43-25-11-15-29-33(21-25)41-31-19-23(37)9-13-27(31)35(29)39-17-7-5-3-4-6-8-18-40-36-28-14-10-24(38)20-32(28)42-34-22-26(44-2)12-16-30(34)36;/h9-16,19-22H,3-8,17-18H2,1-2H3,(H,39,41)(H,40,42);1H |
| InChIKey | LBGGHVUSKWYEIE-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.08 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|