C23H30O7 — CID 54598638
[(11E)-4,6,6,11-tetramethyl-16-methylidene-10,15-dioxo-5,7,14-trioxatricyclo[11.3.0.04,8]hexadec-11-en-2-yl] (E)-2-methylbut-2-enoate (PubChem CID 54598638) has the molecular formula C23H30O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is [(11E)-4,6,6,11-tetramethyl-16-methylidene-10,15-dioxo-5,7,14-trioxatricyclo[11.3.0.04,8]hexadec-11-en-2-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(11E)-4,6,6,11-tetramethyl-16-methylidene-10,15-dioxo-5,7,14-trioxatricyclo[11.3.0.04,8]hexadec-11-en-2-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 54598638 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | [(11E)-4,6,6,11-tetramethyl-16-methylidene-10,15-dioxo-5,7,14-trioxatricyclo[11.3.0.04,8]hexadec-11-en-2-yl] (E)-2-methylbut-2-enoate |
| SMILES | C=C1C(=O)OC2/C=C(\C)C(=O)CC3OC(C)(C)OC3(C)CC(OC(=O)/C(C)=C/C)C12 |
| InChI | InChI=1S/C23H30O7/c1-8-12(2)20(25)28-17-11-23(7)18(29-22(5,6)30-23)10-15(24)13(3)9-16-19(17)14(4)21(26)27-16/h8-9,16-19H,4,10-11H2,1-3,5-7H3/b12-8+,13-9+ |
| InChIKey | FLFMCOUWCKZBIU-QHKWOANTSA-N |
| XLogP | 3.18 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|