C10H14N2NaO3+ — CID 54598988
sodium 5-[(Z)-but-2-en-2-yl]-1-ethyl-1,3-diazinane-2,4,6-trione (PubChem CID 54598988) has the molecular formula C10H14N2NaO3+ and a molecular weight of 233.22 g/mol. Its IUPAC name is sodium 5-[(Z)-but-2-en-2-yl]-1-ethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | sodium 5-[(Z)-but-2-en-2-yl]-1-ethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 54598988 |
| Molecular Formula | C10H14N2NaO3+ |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | sodium 5-[(Z)-but-2-en-2-yl]-1-ethyl-1,3-diazinane-2,4,6-trione |
| SMILES | C/C=C(/C)C1C(=O)NC(=O)N(CC)C1=O.[Na+] |
| InChI | InChI=1S/C10H14N2O3.Na/c1-4-6(3)7-8(13)11-10(15)12(5-2)9(7)14;/h4,7H,5H2,1-3H3,(H,11,13,15);/q;+1/b6-4-; |
| InChIKey | FDHPFBHDKWSOFK-YHSAGPEESA-N |
| XLogP | -2.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|