About 6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate
6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate (PubChem CID 5459900) has the molecular formula C7H4NO3-
and a molecular weight of 150.11 g/mol. Its IUPAC name is 6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate.
Molecular Properties
| Compound Name | 6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate |
| PubChem CID | 5459900 |
| Molecular Formula | C7H4NO3- |
| Molecular Weight | 150.11 g/mol |
| Exact Mass | 150.02 |
| IUPAC Name | 6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate |
| SMILES | [H]/N=C1\C(=O)C=CC=C1C(=O)[O-] |
| InChI | InChI=1S/C7H5NO3/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3,8H,(H,10,11)/p-1/b8-6- |
| InChIKey | BQEPLNUEGNSUTM-VURMDHGXSA-M |
| XLogP | -1.18 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.11 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of 6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate (CID 5459900) is 6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for 6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for 6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate is [H]/N=C1\C(=O)C=CC=C1C(=O)[O-].
What is the InChIKey of 6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate?
The InChIKey is BQEPLNUEGNSUTM-VURMDHGXSA-M. The full InChI is InChI=1S/C7H5NO3/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3,8H,(H,10,11)/p-1/b8-6-.
What are the key properties of 6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate?
6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate has a molecular weight of 150.11 g/mol, XLogP of -1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-imino-5-oxocyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 5459900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).