C10H21ClN2 — CID 54599179
2,3-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline;hydrochloride (PubChem CID 54599179) has the molecular formula C10H21ClN2 and a molecular weight of 204.74 g/mol. Its IUPAC name is 2,3-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline;hydrochloride.
| Compound Name | 2,3-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline;hydrochloride |
|---|---|
| PubChem CID | 54599179 |
| Molecular Formula | C10H21ClN2 |
| Molecular Weight | 204.74 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2,3-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline;hydrochloride |
| SMILES | CC1NC2CCCCC2NC1C.Cl |
| InChI | InChI=1S/C10H20N2.ClH/c1-7-8(2)12-10-6-4-3-5-9(10)11-7;/h7-12H,3-6H2,1-2H3;1H |
| InChIKey | BHNBPLNUNUMSPY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.74 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |