About 2,5-dimethoxy-N,N-dimethyl-4-[(Z)-2-quinolin-4-ylethenyl]aniline
2,5-dimethoxy-N,N-dimethyl-4-[(Z)-2-quinolin-4-ylethenyl]aniline (PubChem CID 54599355) has the molecular formula C21H22N2O2
and a molecular weight of 334.42 g/mol. Its IUPAC name is 2,5-dimethoxy-N,N-dimethyl-4-[(Z)-2-quinolin-4-ylethenyl]aniline.
Molecular Properties
| Compound Name | 2,5-dimethoxy-N,N-dimethyl-4-[(Z)-2-quinolin-4-ylethenyl]aniline |
| PubChem CID | 54599355 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 2,5-dimethoxy-N,N-dimethyl-4-[(Z)-2-quinolin-4-ylethenyl]aniline |
| SMILES | COc1cc(N(C)C)c(OC)cc1/C=C\c1ccnc2ccccc12 |
| InChI | InChI=1S/C21H22N2O2/c1-23(2)19-14-20(24-3)16(13-21(19)25-4)10-9-15-11-12-22-18-8-6-5-7-17(15)18/h5-14H,1-4H3/b10-9- |
| InChIKey | WNRMQAWGIWTTME-KTKRTIGZSA-N |
| XLogP | 4.49 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethoxy-N,N-dimethyl-4-[(Z)-2-quinolin-4-ylethenyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethoxy-N,N-dimethyl-4-[(Z)-2-quinolin-4-ylethenyl]aniline?
The IUPAC name of 2,5-dimethoxy-N,N-dimethyl-4-[(Z)-2-quinolin-4-ylethenyl]aniline (CID 54599355) is 2,5-dimethoxy-N,N-dimethyl-4-[(Z)-2-quinolin-4-ylethenyl]aniline.
What is the SMILES notation for 2,5-dimethoxy-N,N-dimethyl-4-[(Z)-2-quinolin-4-ylethenyl]aniline?
The canonical SMILES for 2,5-dimethoxy-N,N-dimethyl-4-[(Z)-2-quinolin-4-ylethenyl]aniline is COc1cc(N(C)C)c(OC)cc1/C=C\c1ccnc2ccccc12.
What is the InChIKey of 2,5-dimethoxy-N,N-dimethyl-4-[(Z)-2-quinolin-4-ylethenyl]aniline?
The InChIKey is WNRMQAWGIWTTME-KTKRTIGZSA-N. The full InChI is InChI=1S/C21H22N2O2/c1-23(2)19-14-20(24-3)16(13-21(19)25-4)10-9-15-11-12-22-18-8-6-5-7-17(15)18/h5-14H,1-4H3/b10-9-.
What are the key properties of 2,5-dimethoxy-N,N-dimethyl-4-[(Z)-2-quinolin-4-ylethenyl]aniline?
2,5-dimethoxy-N,N-dimethyl-4-[(Z)-2-quinolin-4-ylethenyl]aniline has a molecular weight of 334.42 g/mol, XLogP of 4.49, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethoxy-N,N-dimethyl-4-[(Z)-2-quinolin-4-ylethenyl]aniline is sourced from PubChem (CID 54599355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).