C18H37ClN2 — CID 54599705
6-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N,N-diethylhexan-1-amine;hydrochloride (PubChem CID 54599705) has the molecular formula C18H37ClN2 and a molecular weight of 316.96 g/mol. Its IUPAC name is 6-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N,N-diethylhexan-1-amine;hydrochloride.
| Compound Name | 6-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N,N-diethylhexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 54599705 |
| Molecular Formula | C18H37ClN2 |
| Molecular Weight | 316.96 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 6-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N,N-diethylhexan-1-amine;hydrochloride |
| SMILES | CCN(CC)CCCCCCN1CC2CCCCC2C1.Cl |
| InChI | InChI=1S/C18H36N2.ClH/c1-3-19(4-2)13-9-5-6-10-14-20-15-17-11-7-8-12-18(17)16-20;/h17-18H,3-16H2,1-2H3;1H |
| InChIKey | SRGXBOVQRMEANX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.96 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|