C20H27ClN4O4 — CID 54599742
2-[[2-(dimethylamino)phenyl]carbamoyloxy]ethyl N-[2-(dimethylamino)phenyl]carbamate;hydrochloride (PubChem CID 54599742) has the molecular formula C20H27ClN4O4 and a molecular weight of 422.91 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)phenyl]carbamoyloxy]ethyl N-[2-(dimethylamino)phenyl]carbamate;hydrochloride.
| Compound Name | 2-[[2-(dimethylamino)phenyl]carbamoyloxy]ethyl N-[2-(dimethylamino)phenyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 54599742 |
| Molecular Formula | C20H27ClN4O4 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 2-[[2-(dimethylamino)phenyl]carbamoyloxy]ethyl N-[2-(dimethylamino)phenyl]carbamate;hydrochloride |
| SMILES | CN(C)c1ccccc1NC(=O)OCCOC(=O)Nc1ccccc1N(C)C.Cl |
| InChI | InChI=1S/C20H26N4O4.ClH/c1-23(2)17-11-7-5-9-15(17)21-19(25)27-13-14-28-20(26)22-16-10-6-8-12-18(16)24(3)4;/h5-12H,13-14H2,1-4H3,(H,21,25)(H,22,26);1H |
| InChIKey | OKSZMCTWFBZOFX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|