C24H29Cl4N2+ — CID 54599875
1-[(3,4-dichlorophenyl)methyl]-3-[1-[(3,4-dichlorophenyl)methyl]-1-methylpyrrolidin-1-ium-2-yl]piperidine (PubChem CID 54599875) has the molecular formula C24H29Cl4N2+ and a molecular weight of 487.32 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-[1-[(3,4-dichlorophenyl)methyl]-1-methylpyrrolidin-1-ium-2-yl]piperidine.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-[1-[(3,4-dichlorophenyl)methyl]-1-methylpyrrolidin-1-ium-2-yl]piperidine |
|---|---|
| PubChem CID | 54599875 |
| Molecular Formula | C24H29Cl4N2+ |
| Molecular Weight | 487.32 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-[1-[(3,4-dichlorophenyl)methyl]-1-methylpyrrolidin-1-ium-2-yl]piperidine |
| SMILES | C[N+]1(Cc2ccc(Cl)c(Cl)c2)CCCC1C1CCCN(Cc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C24H29Cl4N2/c1-30(16-18-7-9-21(26)23(28)13-18)11-3-5-24(30)19-4-2-10-29(15-19)14-17-6-8-20(25)22(27)12-17/h6-9,12-13,19,24H,2-5,10-11,14-16H2,1H3/q+1 |
| InChIKey | VCNWWPPKTLBCIZ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.32 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|