About 2-[benzyl(2-hydroxyethyl)amino]-1,2-diphenylethanol;hydrochloride
2-[benzyl(2-hydroxyethyl)amino]-1,2-diphenylethanol;hydrochloride (PubChem CID 54599890) has the molecular formula C23H26ClNO2
and a molecular weight of 383.92 g/mol. Its IUPAC name is 2-[benzyl(2-hydroxyethyl)amino]-1,2-diphenylethanol;hydrochloride.
Molecular Properties
| Compound Name | 2-[benzyl(2-hydroxyethyl)amino]-1,2-diphenylethanol;hydrochloride |
| PubChem CID | 54599890 |
| Molecular Formula | C23H26ClNO2 |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-[benzyl(2-hydroxyethyl)amino]-1,2-diphenylethanol;hydrochloride |
| SMILES | Cl.OCCN(Cc1ccccc1)C(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C23H25NO2.ClH/c25-17-16-24(18-19-10-4-1-5-11-19)22(20-12-6-2-7-13-20)23(26)21-14-8-3-9-15-21;/h1-15,22-23,25-26H,16-18H2;1H |
| InChIKey | YVOMVPILAOGEOW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[benzyl(2-hydroxyethyl)amino]-1,2-diphenylethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[benzyl(2-hydroxyethyl)amino]-1,2-diphenylethanol;hydrochloride?
The IUPAC name of 2-[benzyl(2-hydroxyethyl)amino]-1,2-diphenylethanol;hydrochloride (CID 54599890) is 2-[benzyl(2-hydroxyethyl)amino]-1,2-diphenylethanol;hydrochloride.
What is the SMILES notation for 2-[benzyl(2-hydroxyethyl)amino]-1,2-diphenylethanol;hydrochloride?
The canonical SMILES for 2-[benzyl(2-hydroxyethyl)amino]-1,2-diphenylethanol;hydrochloride is Cl.OCCN(Cc1ccccc1)C(c1ccccc1)C(O)c1ccccc1.
What is the InChIKey of 2-[benzyl(2-hydroxyethyl)amino]-1,2-diphenylethanol;hydrochloride?
The InChIKey is YVOMVPILAOGEOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25NO2.ClH/c25-17-16-24(18-19-10-4-1-5-11-19)22(20-12-6-2-7-13-20)23(26)21-14-8-3-9-15-21;/h1-15,22-23,25-26H,16-18H2;1H.
What are the key properties of 2-[benzyl(2-hydroxyethyl)amino]-1,2-diphenylethanol;hydrochloride?
2-[benzyl(2-hydroxyethyl)amino]-1,2-diphenylethanol;hydrochloride has a molecular weight of 383.92 g/mol, XLogP of 4.38, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[benzyl(2-hydroxyethyl)amino]-1,2-diphenylethanol;hydrochloride is sourced from PubChem (CID 54599890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).