C5H10O4 — CID 5460005
(3S,4R)-3,4,5-trihydroxypentanal (PubChem CID 5460005) has the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. Its IUPAC name is (3S,4R)-3,4,5-trihydroxypentanal.
| Compound Name | (3S,4R)-3,4,5-trihydroxypentanal |
|---|---|
| PubChem CID | 5460005 |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | (3S,4R)-3,4,5-trihydroxypentanal |
| SMILES | O=CC[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C5H10O4/c6-2-1-4(8)5(9)3-7/h2,4-5,7-9H,1,3H2/t4-,5+/m0/s1 |
| InChIKey | ASJSAQIRZKANQN-CRCLSJGQSA-N |
| XLogP | -1.71 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|