About sodium 5-phenyl-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione
sodium 5-phenyl-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 54600111) has the molecular formula C13H12N2NaO2S+
and a molecular weight of 283.31 g/mol. Its IUPAC name is sodium 5-phenyl-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
Molecular Properties
| Compound Name | sodium 5-phenyl-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| PubChem CID | 54600111 |
| Molecular Formula | C13H12N2NaO2S+ |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | sodium 5-phenyl-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | C=CCN1C(=O)C(c2ccccc2)C(=O)NC1=S.[Na+] |
| InChI | InChI=1S/C13H12N2O2S.Na/c1-2-8-15-12(17)10(11(16)14-13(15)18)9-6-4-3-5-7-9;/h2-7,10H,1,8H2,(H,14,16,18);/q;+1 |
| InChIKey | OBAGQZMFERMUDW-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium 5-phenyl-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 5-phenyl-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione?
The IUPAC name of sodium 5-phenyl-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione (CID 54600111) is sodium 5-phenyl-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
What is the SMILES notation for sodium 5-phenyl-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione?
The canonical SMILES for sodium 5-phenyl-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione is C=CCN1C(=O)C(c2ccccc2)C(=O)NC1=S.[Na+].
What is the InChIKey of sodium 5-phenyl-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione?
The InChIKey is OBAGQZMFERMUDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O2S.Na/c1-2-8-15-12(17)10(11(16)14-13(15)18)9-6-4-3-5-7-9;/h2-7,10H,1,8H2,(H,14,16,18);/q;+1.
What are the key properties of sodium 5-phenyl-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione?
sodium 5-phenyl-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione has a molecular weight of 283.31 g/mol, XLogP of -1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5-phenyl-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione is sourced from PubChem (CID 54600111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).