C38H59N3O10 — CID 54600372
[(6Z)-13-hydroxy-21-[[hydroxy(octyl)amino]methyl]-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate (PubChem CID 54600372) has the molecular formula C38H59N3O10 and a molecular weight of 717.90 g/mol. Its IUPAC name is [(6Z)-13-hydroxy-21-[[hydroxy(octyl)amino]methyl]-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate.
| Compound Name | [(6Z)-13-hydroxy-21-[[hydroxy(octyl)amino]methyl]-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
|---|---|
| PubChem CID | 54600372 |
| Molecular Formula | C38H59N3O10 |
| Molecular Weight | 717.90 g/mol |
| Exact Mass | 717.42 |
| IUPAC Name | [(6Z)-13-hydroxy-21-[[hydroxy(octyl)amino]methyl]-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
| SMILES | CCCCCCCCN(O)CC1=C2NC(=O)C(C)=C/C=C\C(OC)C(OC(N)=O)C(C)=CC(C)C(O)C(OC)CC(C)CC(=C(OC)C1=O)C2=O |
| InChI | InChI=1S/C38H59N3O10/c1-9-10-11-12-13-14-18-41(47)22-28-31-33(43)27(36(50-8)34(28)44)19-23(2)20-30(49-7)32(42)25(4)21-26(5)35(51-38(39)46)29(48-6)17-15-16-24(3)37(45)40-31/h15-17,21,23,25,29-30,32,35,42,47H,9-14,18-20,22H2,1-8H3,(H2,39,46)(H,40,45)/b17-15-,24-16?,26-21? |
| InChIKey | JAPFPWZOWITWEM-DGMWMMMXSA-N |
| XLogP | 4.83 |
| TPSA | 186.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.90 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|