C15H28N2 — CID 54600401
2-[(1Z)-2,6-dimethylhepta-1,5-dienyl]-1,3-dimethyl-1,3-diazinane (PubChem CID 54600401) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 2-[(1Z)-2,6-dimethylhepta-1,5-dienyl]-1,3-dimethyl-1,3-diazinane.
| Compound Name | 2-[(1Z)-2,6-dimethylhepta-1,5-dienyl]-1,3-dimethyl-1,3-diazinane |
|---|---|
| PubChem CID | 54600401 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 2-[(1Z)-2,6-dimethylhepta-1,5-dienyl]-1,3-dimethyl-1,3-diazinane |
| SMILES | CC(C)=CCC/C(C)=C\C1N(C)CCCN1C |
| InChI | InChI=1S/C15H28N2/c1-13(2)8-6-9-14(3)12-15-16(4)10-7-11-17(15)5/h8,12,15H,6-7,9-11H2,1-5H3/b14-12- |
| InChIKey | HRPUNUYSOQBKCV-OWBHPGMISA-N |
| XLogP | 3.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|