C6H14O6 — CID 5460044
(2S,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol (PubChem CID 5460044) has the molecular formula C6H14O6 and a molecular weight of 182.17 g/mol. Its IUPAC name is (2S,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 5460044 |
| Molecular Formula | C6H14O6 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | (2S,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol |
| SMILES | OC[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5+,6+/m0/s1 |
| InChIKey | FBPFZTCFMRRESA-UNTFVMJOSA-N |
| XLogP | -3.59 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |