About 1,2-dihydropyridazine-3,6-dione;nickel
1,2-dihydropyridazine-3,6-dione;nickel (PubChem CID 54600507) has the molecular formula C4H4N2NiO2
and a molecular weight of 170.78 g/mol. Its IUPAC name is 1,2-dihydropyridazine-3,6-dione;nickel.
Molecular Properties
| Compound Name | 1,2-dihydropyridazine-3,6-dione;nickel |
| PubChem CID | 54600507 |
| Molecular Formula | C4H4N2NiO2 |
| Molecular Weight | 170.78 g/mol |
| Exact Mass | 169.96 |
| IUPAC Name | 1,2-dihydropyridazine-3,6-dione;nickel |
| SMILES | O=c1ccc(=O)[nH][nH]1.[Ni] |
| InChI | InChI=1S/C4H4N2O2.Ni/c7-3-1-2-4(8)6-5-3;/h1-2H,(H,5,7)(H,6,8); |
| InChIKey | PMBKGLCLRYDCAZ-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.78 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dihydropyridazine-3,6-dione;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydropyridazine-3,6-dione;nickel?
The IUPAC name of 1,2-dihydropyridazine-3,6-dione;nickel (CID 54600507) is 1,2-dihydropyridazine-3,6-dione;nickel.
What is the SMILES notation for 1,2-dihydropyridazine-3,6-dione;nickel?
The canonical SMILES for 1,2-dihydropyridazine-3,6-dione;nickel is O=c1ccc(=O)[nH][nH]1.[Ni].
What is the InChIKey of 1,2-dihydropyridazine-3,6-dione;nickel?
The InChIKey is PMBKGLCLRYDCAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2.Ni/c7-3-1-2-4(8)6-5-3;/h1-2H,(H,5,7)(H,6,8);.
What are the key properties of 1,2-dihydropyridazine-3,6-dione;nickel?
1,2-dihydropyridazine-3,6-dione;nickel has a molecular weight of 170.78 g/mol, XLogP of -0.94, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydropyridazine-3,6-dione;nickel is sourced from PubChem (CID 54600507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).