About (1E)-1-[amino-(3,5-dimethylpyrazol-1-yl)methylidene]-3-methylthiourea
(1E)-1-[amino-(3,5-dimethylpyrazol-1-yl)methylidene]-3-methylthiourea (PubChem CID 54600582) has the molecular formula C8H13N5S
and a molecular weight of 211.29 g/mol. Its IUPAC name is (1E)-1-[amino-(3,5-dimethylpyrazol-1-yl)methylidene]-3-methylthiourea.
Molecular Properties
| Compound Name | (1E)-1-[amino-(3,5-dimethylpyrazol-1-yl)methylidene]-3-methylthiourea |
| PubChem CID | 54600582 |
| Molecular Formula | C8H13N5S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | (1E)-1-[amino-(3,5-dimethylpyrazol-1-yl)methylidene]-3-methylthiourea |
| SMILES | CNC(=S)/N=C(\N)n1nc(C)cc1C |
| InChI | InChI=1S/C8H13N5S/c1-5-4-6(2)13(12-5)7(9)11-8(14)10-3/h4H,1-3H3,(H3,9,10,11,14) |
| InChIKey | ZJRDROZRASXMNK-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-[amino-(3,5-dimethylpyrazol-1-yl)methylidene]-3-methylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-[amino-(3,5-dimethylpyrazol-1-yl)methylidene]-3-methylthiourea?
The IUPAC name of (1E)-1-[amino-(3,5-dimethylpyrazol-1-yl)methylidene]-3-methylthiourea (CID 54600582) is (1E)-1-[amino-(3,5-dimethylpyrazol-1-yl)methylidene]-3-methylthiourea.
What is the SMILES notation for (1E)-1-[amino-(3,5-dimethylpyrazol-1-yl)methylidene]-3-methylthiourea?
The canonical SMILES for (1E)-1-[amino-(3,5-dimethylpyrazol-1-yl)methylidene]-3-methylthiourea is CNC(=S)/N=C(\N)n1nc(C)cc1C.
What is the InChIKey of (1E)-1-[amino-(3,5-dimethylpyrazol-1-yl)methylidene]-3-methylthiourea?
The InChIKey is ZJRDROZRASXMNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5S/c1-5-4-6(2)13(12-5)7(9)11-8(14)10-3/h4H,1-3H3,(H3,9,10,11,14).
What are the key properties of (1E)-1-[amino-(3,5-dimethylpyrazol-1-yl)methylidene]-3-methylthiourea?
(1E)-1-[amino-(3,5-dimethylpyrazol-1-yl)methylidene]-3-methylthiourea has a molecular weight of 211.29 g/mol, XLogP of 0.17, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-[amino-(3,5-dimethylpyrazol-1-yl)methylidene]-3-methylthiourea is sourced from PubChem (CID 54600582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).