C12H11ClN2 — CID 54600673
7,10-diazatricyclo[8.4.0.02,7]tetradeca-1,3,5,8,11,13-hexaene;hydrochloride (PubChem CID 54600673) has the molecular formula C12H11ClN2 and a molecular weight of 218.69 g/mol. Its IUPAC name is 7,10-diazatricyclo[8.4.0.02,7]tetradeca-1,3,5,8,11,13-hexaene;hydrochloride.
| Compound Name | 7,10-diazatricyclo[8.4.0.02,7]tetradeca-1,3,5,8,11,13-hexaene;hydrochloride |
|---|---|
| PubChem CID | 54600673 |
| Molecular Formula | C12H11ClN2 |
| Molecular Weight | 218.69 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 7,10-diazatricyclo[8.4.0.02,7]tetradeca-1,3,5,8,11,13-hexaene;hydrochloride |
| SMILES | C1=CC2=C3C=CC=CN3C=CN2C=C1.Cl |
| InChI | InChI=1S/C12H10N2.ClH/c1-3-7-13-9-10-14-8-4-2-6-12(14)11(13)5-1;/h1-10H;1H |
| InChIKey | PHJUAKPDXVJMLD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.69 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |