C28H39ClN4O8 — CID 54600783
[5-[(2-amino-4-methylpentanoyl)oxymethyl]-4,6,11,13-tetraoxo-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]methyl 2-amino-4-methylpentanoate;hydrochloride (PubChem CID 54600783) has the molecular formula C28H39ClN4O8 and a molecular weight of 595.09 g/mol. Its IUPAC name is [5-[(2-amino-4-methylpentanoyl)oxymethyl]-4,6,11,13-tetraoxo-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]methyl 2-amino-4-methylpentanoate;hydrochloride.
| Compound Name | [5-[(2-amino-4-methylpentanoyl)oxymethyl]-4,6,11,13-tetraoxo-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]methyl 2-amino-4-methylpentanoate;hydrochloride |
|---|---|
| PubChem CID | 54600783 |
| Molecular Formula | C28H39ClN4O8 |
| Molecular Weight | 595.09 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | [5-[(2-amino-4-methylpentanoyl)oxymethyl]-4,6,11,13-tetraoxo-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]methyl 2-amino-4-methylpentanoate;hydrochloride |
| SMILES | CC(C)CC(N)C(=O)OCN1C(=O)C2C3C=CC(C2C1=O)C1C2C(=O)N(COC(=O)C(N)CC(C)C)C(=O)C2C31.Cl |
| InChI | InChI=1S/C28H38N4O8.ClH/c1-11(2)7-15(29)27(37)39-9-31-23(33)19-13-5-6-14(20(19)24(31)34)18-17(13)21-22(18)26(36)32(25(21)35)10-40-28(38)16(30)8-12(3)4;/h5-6,11-22H,7-10,29-30H2,1-4H3;1H |
| InChIKey | QHOXBDOAVDSMEF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 179.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.09 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|