About (2E)-2-[(6-chloro-1,3-benzodioxol-5-yl)methoxyimino]propanoic acid
(2E)-2-[(6-chloro-1,3-benzodioxol-5-yl)methoxyimino]propanoic acid (PubChem CID 54600925) has the molecular formula C11H10ClNO5
and a molecular weight of 271.66 g/mol. Its IUPAC name is (2E)-2-[(6-chloro-1,3-benzodioxol-5-yl)methoxyimino]propanoic acid.
Molecular Properties
| Compound Name | (2E)-2-[(6-chloro-1,3-benzodioxol-5-yl)methoxyimino]propanoic acid |
| PubChem CID | 54600925 |
| Molecular Formula | C11H10ClNO5 |
| Molecular Weight | 271.66 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | (2E)-2-[(6-chloro-1,3-benzodioxol-5-yl)methoxyimino]propanoic acid |
| SMILES | C/C(=N\OCc1cc2c(cc1Cl)OCO2)C(=O)O |
| InChI | InChI=1S/C11H10ClNO5/c1-6(11(14)15)13-18-4-7-2-9-10(3-8(7)12)17-5-16-9/h2-3H,4-5H2,1H3,(H,14,15)/b13-6+ |
| InChIKey | ZZPCDYJZSCNKKK-AWNIVKPZSA-N |
| XLogP | 2.05 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.66 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(6-chloro-1,3-benzodioxol-5-yl)methoxyimino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(6-chloro-1,3-benzodioxol-5-yl)methoxyimino]propanoic acid?
The IUPAC name of (2E)-2-[(6-chloro-1,3-benzodioxol-5-yl)methoxyimino]propanoic acid (CID 54600925) is (2E)-2-[(6-chloro-1,3-benzodioxol-5-yl)methoxyimino]propanoic acid.
What is the SMILES notation for (2E)-2-[(6-chloro-1,3-benzodioxol-5-yl)methoxyimino]propanoic acid?
The canonical SMILES for (2E)-2-[(6-chloro-1,3-benzodioxol-5-yl)methoxyimino]propanoic acid is C/C(=N\OCc1cc2c(cc1Cl)OCO2)C(=O)O.
What is the InChIKey of (2E)-2-[(6-chloro-1,3-benzodioxol-5-yl)methoxyimino]propanoic acid?
The InChIKey is ZZPCDYJZSCNKKK-AWNIVKPZSA-N. The full InChI is InChI=1S/C11H10ClNO5/c1-6(11(14)15)13-18-4-7-2-9-10(3-8(7)12)17-5-16-9/h2-3H,4-5H2,1H3,(H,14,15)/b13-6+.
What are the key properties of (2E)-2-[(6-chloro-1,3-benzodioxol-5-yl)methoxyimino]propanoic acid?
(2E)-2-[(6-chloro-1,3-benzodioxol-5-yl)methoxyimino]propanoic acid has a molecular weight of 271.66 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(6-chloro-1,3-benzodioxol-5-yl)methoxyimino]propanoic acid is sourced from PubChem (CID 54600925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).