C12H10O2S — CID 5460102
(1R,2S)-1,2-dihydrodibenzothiophene-1,2-diol (PubChem CID 5460102) has the molecular formula C12H10O2S and a molecular weight of 218.28 g/mol. Its IUPAC name is (1R,2S)-1,2-dihydrodibenzothiophene-1,2-diol.
| Compound Name | (1R,2S)-1,2-dihydrodibenzothiophene-1,2-diol |
|---|---|
| PubChem CID | 5460102 |
| Molecular Formula | C12H10O2S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | (1R,2S)-1,2-dihydrodibenzothiophene-1,2-diol |
| SMILES | O[C@@H]1c2c(sc3ccccc23)C=C[C@@H]1O |
| InChI | InChI=1S/C12H10O2S/c13-8-5-6-10-11(12(8)14)7-3-1-2-4-9(7)15-10/h1-6,8,12-14H/t8-,12-/m0/s1 |
| InChIKey | OOOXLVUNFHBSNL-UFBFGSQYSA-N |
| XLogP | 2.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |