About sulfuric acid;2-tridecylguanidine
sulfuric acid;2-tridecylguanidine (PubChem CID 54601090) has the molecular formula C14H33N3O4S
and a molecular weight of 339.50 g/mol. Its IUPAC name is sulfuric acid;2-tridecylguanidine.
Molecular Properties
| Compound Name | sulfuric acid;2-tridecylguanidine |
| PubChem CID | 54601090 |
| Molecular Formula | C14H33N3O4S |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | sulfuric acid;2-tridecylguanidine |
| SMILES | CCCCCCCCCCCCCN=C(N)N.O=S(=O)(O)O |
| InChI | InChI=1S/C14H31N3.H2O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-14(15)16;1-5(2,3)4/h2-13H2,1H3,(H4,15,16,17);(H2,1,2,3,4) |
| InChIKey | TYETYSBJSNVGBY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sulfuric acid;2-tridecylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfuric acid;2-tridecylguanidine?
The IUPAC name of sulfuric acid;2-tridecylguanidine (CID 54601090) is sulfuric acid;2-tridecylguanidine.
What is the SMILES notation for sulfuric acid;2-tridecylguanidine?
The canonical SMILES for sulfuric acid;2-tridecylguanidine is CCCCCCCCCCCCCN=C(N)N.O=S(=O)(O)O.
What is the InChIKey of sulfuric acid;2-tridecylguanidine?
The InChIKey is TYETYSBJSNVGBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31N3.H2O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-14(15)16;1-5(2,3)4/h2-13H2,1H3,(H4,15,16,17);(H2,1,2,3,4).
What are the key properties of sulfuric acid;2-tridecylguanidine?
sulfuric acid;2-tridecylguanidine has a molecular weight of 339.50 g/mol, XLogP of 2.92, 12 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sulfuric acid;2-tridecylguanidine is sourced from PubChem (CID 54601090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).