About potassium (2-ethoxy-3-propan-2-yloxypropoxy)methanethioic S-acid
potassium (2-ethoxy-3-propan-2-yloxypropoxy)methanethioic S-acid (PubChem CID 54601663) has the molecular formula C9H18KO4S+
and a molecular weight of 261.40 g/mol. Its IUPAC name is potassium (2-ethoxy-3-propan-2-yloxypropoxy)methanethioic S-acid.
Molecular Properties
| Compound Name | potassium (2-ethoxy-3-propan-2-yloxypropoxy)methanethioic S-acid |
| PubChem CID | 54601663 |
| Molecular Formula | C9H18KO4S+ |
| Molecular Weight | 261.40 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | potassium (2-ethoxy-3-propan-2-yloxypropoxy)methanethioic S-acid |
| SMILES | CCOC(COC(=O)S)COC(C)C.[K+] |
| InChI | InChI=1S/C9H18O4S.K/c1-4-11-8(5-12-7(2)3)6-13-9(10)14;/h7-8H,4-6H2,1-3H3,(H,10,14);/q;+1 |
| InChIKey | SLSINDYLFZAQQP-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.40 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze potassium (2-ethoxy-3-propan-2-yloxypropoxy)methanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium (2-ethoxy-3-propan-2-yloxypropoxy)methanethioic S-acid?
The IUPAC name of potassium (2-ethoxy-3-propan-2-yloxypropoxy)methanethioic S-acid (CID 54601663) is potassium (2-ethoxy-3-propan-2-yloxypropoxy)methanethioic S-acid.
What is the SMILES notation for potassium (2-ethoxy-3-propan-2-yloxypropoxy)methanethioic S-acid?
The canonical SMILES for potassium (2-ethoxy-3-propan-2-yloxypropoxy)methanethioic S-acid is CCOC(COC(=O)S)COC(C)C.[K+].
What is the InChIKey of potassium (2-ethoxy-3-propan-2-yloxypropoxy)methanethioic S-acid?
The InChIKey is SLSINDYLFZAQQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O4S.K/c1-4-11-8(5-12-7(2)3)6-13-9(10)14;/h7-8H,4-6H2,1-3H3,(H,10,14);/q;+1.
What are the key properties of potassium (2-ethoxy-3-propan-2-yloxypropoxy)methanethioic S-acid?
potassium (2-ethoxy-3-propan-2-yloxypropoxy)methanethioic S-acid has a molecular weight of 261.40 g/mol, XLogP of -1.11, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (2-ethoxy-3-propan-2-yloxypropoxy)methanethioic S-acid is sourced from PubChem (CID 54601663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).