About 1-hydroxypropane-1,2,3-tricarboxylate
1-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 5460172) has the molecular formula C6H5O7-3
and a molecular weight of 189.10 g/mol. Its IUPAC name is 1-hydroxypropane-1,2,3-tricarboxylate.
Molecular Properties
| Compound Name | 1-hydroxypropane-1,2,3-tricarboxylate |
| PubChem CID | 5460172 |
| Molecular Formula | C6H5O7-3 |
| Molecular Weight | 189.10 g/mol |
| Exact Mass | 189.01 |
| IUPAC Name | 1-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | O=C([O-])CC(C(=O)[O-])C(O)C(=O)[O-] |
| InChI | InChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/p-3 |
| InChIKey | ODBLHEXUDAPZAU-UHFFFAOYSA-K |
| XLogP | -5.40 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.10 |
| LogP ≤ 5 | -5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-hydroxypropane-1,2,3-tricarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypropane-1,2,3-tricarboxylate?
The IUPAC name of 1-hydroxypropane-1,2,3-tricarboxylate (CID 5460172) is 1-hydroxypropane-1,2,3-tricarboxylate.
What is the SMILES notation for 1-hydroxypropane-1,2,3-tricarboxylate?
The canonical SMILES for 1-hydroxypropane-1,2,3-tricarboxylate is O=C([O-])CC(C(=O)[O-])C(O)C(=O)[O-].
What is the InChIKey of 1-hydroxypropane-1,2,3-tricarboxylate?
The InChIKey is ODBLHEXUDAPZAU-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/p-3.
What are the key properties of 1-hydroxypropane-1,2,3-tricarboxylate?
1-hydroxypropane-1,2,3-tricarboxylate has a molecular weight of 189.10 g/mol, XLogP of -5.40, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypropane-1,2,3-tricarboxylate is sourced from PubChem (CID 5460172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).