About copper 2,4,6-triiodophenol
copper 2,4,6-triiodophenol (PubChem CID 54602337) has the molecular formula C6H3CuI3O+2
and a molecular weight of 535.35 g/mol. Its IUPAC name is copper 2,4,6-triiodophenol.
Molecular Properties
| Compound Name | copper 2,4,6-triiodophenol |
| PubChem CID | 54602337 |
| Molecular Formula | C6H3CuI3O+2 |
| Molecular Weight | 535.35 g/mol |
| Exact Mass | 534.66 |
| IUPAC Name | copper 2,4,6-triiodophenol |
| SMILES | Oc1c(I)cc(I)cc1I.[Cu+2] |
| InChI | InChI=1S/C6H3I3O.Cu/c7-3-1-4(8)6(10)5(9)2-3;/h1-2,10H;/q;+2 |
| InChIKey | VMCZKCFJHVRZIQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 535.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze copper 2,4,6-triiodophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper 2,4,6-triiodophenol?
The IUPAC name of copper 2,4,6-triiodophenol (CID 54602337) is copper 2,4,6-triiodophenol.
What is the SMILES notation for copper 2,4,6-triiodophenol?
The canonical SMILES for copper 2,4,6-triiodophenol is Oc1c(I)cc(I)cc1I.[Cu+2].
What is the InChIKey of copper 2,4,6-triiodophenol?
The InChIKey is VMCZKCFJHVRZIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3I3O.Cu/c7-3-1-4(8)6(10)5(9)2-3;/h1-2,10H;/q;+2.
What are the key properties of copper 2,4,6-triiodophenol?
copper 2,4,6-triiodophenol has a molecular weight of 535.35 g/mol, XLogP of 3.20, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for copper 2,4,6-triiodophenol is sourced from PubChem (CID 54602337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).