C11H18ClN — CID 54602364
2-(2,4,5-trimethylphenyl)ethanamine;hydrochloride (PubChem CID 54602364) has the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. Its IUPAC name is 2-(2,4,5-trimethylphenyl)ethanamine;hydrochloride.
| Compound Name | 2-(2,4,5-trimethylphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 54602364 |
| Molecular Formula | C11H18ClN |
| Molecular Weight | 199.72 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 2-(2,4,5-trimethylphenyl)ethanamine;hydrochloride |
| SMILES | Cc1cc(C)c(CCN)cc1C.Cl |
| InChI | InChI=1S/C11H17N.ClH/c1-8-6-10(3)11(4-5-12)7-9(8)2;/h6-7H,4-5,12H2,1-3H3;1H |
| InChIKey | BTGILAFIBLTYOO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.72 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |