About piperazine;thiophene-2-carboxylic acid
piperazine;thiophene-2-carboxylic acid (PubChem CID 54602430) has the molecular formula C9H14N2O2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is piperazine;thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | piperazine;thiophene-2-carboxylic acid |
| PubChem CID | 54602430 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | piperazine;thiophene-2-carboxylic acid |
| SMILES | C1CNCCN1.O=C(O)c1cccs1 |
| InChI | InChI=1S/C5H4O2S.C4H10N2/c6-5(7)4-2-1-3-8-4;1-2-6-4-3-5-1/h1-3H,(H,6,7);5-6H,1-4H2 |
| InChIKey | QOIZDMYEDBRHCD-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperazine;thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine;thiophene-2-carboxylic acid?
The IUPAC name of piperazine;thiophene-2-carboxylic acid (CID 54602430) is piperazine;thiophene-2-carboxylic acid.
What is the SMILES notation for piperazine;thiophene-2-carboxylic acid?
The canonical SMILES for piperazine;thiophene-2-carboxylic acid is C1CNCCN1.O=C(O)c1cccs1.
What is the InChIKey of piperazine;thiophene-2-carboxylic acid?
The InChIKey is QOIZDMYEDBRHCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4O2S.C4H10N2/c6-5(7)4-2-1-3-8-4;1-2-6-4-3-5-1/h1-3H,(H,6,7);5-6H,1-4H2.
What are the key properties of piperazine;thiophene-2-carboxylic acid?
piperazine;thiophene-2-carboxylic acid has a molecular weight of 214.29 g/mol, XLogP of 0.63, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine;thiophene-2-carboxylic acid is sourced from PubChem (CID 54602430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).