C16H26O10S — CID 54602571
propane-2,2-diol;(2,3,4,5-tetrahydroxy-6-oxohexyl) 4-methylbenzenesulfonate (PubChem CID 54602571) has the molecular formula C16H26O10S and a molecular weight of 410.44 g/mol. Its IUPAC name is propane-2,2-diol;(2,3,4,5-tetrahydroxy-6-oxohexyl) 4-methylbenzenesulfonate.
| Compound Name | propane-2,2-diol;(2,3,4,5-tetrahydroxy-6-oxohexyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54602571 |
| Molecular Formula | C16H26O10S |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | propane-2,2-diol;(2,3,4,5-tetrahydroxy-6-oxohexyl) 4-methylbenzenesulfonate |
| SMILES | CC(C)(O)O.Cc1ccc(S(=O)(=O)OCC(O)C(O)C(O)C(O)C=O)cc1 |
| InChI | InChI=1S/C13H18O8S.C3H8O2/c1-8-2-4-9(5-3-8)22(19,20)21-7-11(16)13(18)12(17)10(15)6-14;1-3(2,4)5/h2-6,10-13,15-18H,7H2,1H3;4-5H,1-2H3 |
| InChIKey | IOUCXNIGBFNYSY-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|