C7H9O6- — CID 5460271
(1R,3R,4S)-1,3,4-trihydroxy-5-oxocyclohexane-1-carboxylate (PubChem CID 5460271) has the molecular formula C7H9O6- and a molecular weight of 189.14 g/mol. Its IUPAC name is (1R,3R,4S)-1,3,4-trihydroxy-5-oxocyclohexane-1-carboxylate.
| Compound Name | (1R,3R,4S)-1,3,4-trihydroxy-5-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 5460271 |
| Molecular Formula | C7H9O6- |
| Molecular Weight | 189.14 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | (1R,3R,4S)-1,3,4-trihydroxy-5-oxocyclohexane-1-carboxylate |
| SMILES | O=C1C[C@@](O)(C(=O)[O-])C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H10O6/c8-3-1-7(13,6(11)12)2-4(9)5(3)10/h3,5,8,10,13H,1-2H2,(H,11,12)/p-1/t3-,5+,7-/m1/s1 |
| InChIKey | WVMWZWGZRAXUBK-SYTVJDICSA-M |
| XLogP | -3.45 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.14 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |