About hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;imino(triphenyl)-λ5-phosphane
hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;imino(triphenyl)-λ5-phosphane (PubChem CID 54602752) has the molecular formula C18H18Cr2NO7P
and a molecular weight of 495.31 g/mol. Its IUPAC name is hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;imino(triphenyl)-λ5-phosphane.
Molecular Properties
| Compound Name | hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;imino(triphenyl)-λ5-phosphane |
| PubChem CID | 54602752 |
| Molecular Formula | C18H18Cr2NO7P |
| Molecular Weight | 495.31 g/mol |
| Exact Mass | 494.96 |
| IUPAC Name | hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;imino(triphenyl)-λ5-phosphane |
| SMILES | O=[Cr](=O)(O)O[Cr](=O)(=O)O.[H]N=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H16NP.2Cr.2H2O.5O/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;;;;;/h1-15,19H;;;2*1H2;;;;;/q;2*+1;;;;;;;/p-2 |
| InChIKey | MYBRUKBJRCOJMB-UHFFFAOYSA-L |
| XLogP | 2.08 |
| TPSA | 141.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;imino(triphenyl)-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;imino(triphenyl)-λ5-phosphane?
The IUPAC name of hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;imino(triphenyl)-λ5-phosphane (CID 54602752) is hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;imino(triphenyl)-λ5-phosphane.
What is the SMILES notation for hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;imino(triphenyl)-λ5-phosphane?
The canonical SMILES for hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;imino(triphenyl)-λ5-phosphane is O=[Cr](=O)(O)O[Cr](=O)(=O)O.[H]N=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;imino(triphenyl)-λ5-phosphane?
The InChIKey is MYBRUKBJRCOJMB-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H16NP.2Cr.2H2O.5O/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;;;;;/h1-15,19H;;;2*1H2;;;;;/q;2*+1;;;;;;;/p-2.
What are the key properties of hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;imino(triphenyl)-λ5-phosphane?
hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;imino(triphenyl)-λ5-phosphane has a molecular weight of 495.31 g/mol, XLogP of 2.08, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;imino(triphenyl)-λ5-phosphane is sourced from PubChem (CID 54602752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).