(1R,2S)-1-hydroxybutane-1,2,4-tricarboxylic acid

C7H10O7 — CID 5460287

IUPAC(1R,2S)-1-hydroxybutane-1,2,4-tricarboxylic acid
SMILESO=C(O)CCC(C(=O)O)[C@@H](O)C(=O)O
InChIInChI=1S/C7H10O7/c8-4(9)2-1-3(6(11)12)5(10)7(13)14/h3,5,10H,1-2H2,(H,8,9)(H,11,12)(H,13,14)/t3?,5-/m1/s1
InChIKeyOEJZZCGRGVFWHK-SDMSXHDGSA-N
MW206.15 g/mol
LogP-1.00
Rot. Bonds6

About (1R,2S)-1-hydroxybutane-1,2,4-tricarboxylic acid

(1R,2S)-1-hydroxybutane-1,2,4-tricarboxylic acid (PubChem CID 5460287) has the molecular formula C7H10O7 and a molecular weight of 206.15 g/mol. Its IUPAC name is (1R,2S)-1-hydroxybutane-1,2,4-tricarboxylic acid.

Molecular Properties

Compound Name(1R,2S)-1-hydroxybutane-1,2,4-tricarboxylic acid
PubChem CID5460287
Molecular FormulaC7H10O7
Molecular Weight206.15 g/mol
Exact Mass206.04
IUPAC Name(1R,2S)-1-hydroxybutane-1,2,4-tricarboxylic acid
SMILESO=C(O)CCC(C(=O)O)[C@@H](O)C(=O)O
InChIInChI=1S/C7H10O7/c8-4(9)2-1-3(6(11)12)5(10)7(13)14/h3,5,10H,1-2H2,(H,8,9)(H,11,12)(H,13,14)/t3?,5-/m1/s1
InChIKeyOEJZZCGRGVFWHK-SDMSXHDGSA-N
XLogP-1.00
TPSA132.13 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.15
LogP ≤ 5-1.00
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze (1R,2S)-1-hydroxybutane-1,2,4-tricarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1R,2S)-1-hydroxybutane-1,2,4-tricarboxylic acid?
The IUPAC name of (1R,2S)-1-hydroxybutane-1,2,4-tricarboxylic acid (CID 5460287) is (1R,2S)-1-hydroxybutane-1,2,4-tricarboxylic acid.
What is the SMILES notation for (1R,2S)-1-hydroxybutane-1,2,4-tricarboxylic acid?
The canonical SMILES for (1R,2S)-1-hydroxybutane-1,2,4-tricarboxylic acid is O=C(O)CCC(C(=O)O)[C@@H](O)C(=O)O.
What is the InChIKey of (1R,2S)-1-hydroxybutane-1,2,4-tricarboxylic acid?
The InChIKey is OEJZZCGRGVFWHK-SDMSXHDGSA-N. The full InChI is InChI=1S/C7H10O7/c8-4(9)2-1-3(6(11)12)5(10)7(13)14/h3,5,10H,1-2H2,(H,8,9)(H,11,12)(H,13,14)/t3?,5-/m1/s1.
What are the key properties of (1R,2S)-1-hydroxybutane-1,2,4-tricarboxylic acid?
(1R,2S)-1-hydroxybutane-1,2,4-tricarboxylic acid has a molecular weight of 206.15 g/mol, XLogP of -1.00, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S)-1-hydroxybutane-1,2,4-tricarboxylic acid is sourced from PubChem (CID 5460287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).