About 2-benzyl-1-(2-phenylethyl)-4,5-dihydroimidazole;hydrochloride
2-benzyl-1-(2-phenylethyl)-4,5-dihydroimidazole;hydrochloride (PubChem CID 54602889) has the molecular formula C18H21ClN2
and a molecular weight of 300.83 g/mol. Its IUPAC name is 2-benzyl-1-(2-phenylethyl)-4,5-dihydroimidazole;hydrochloride.
Molecular Properties
| Compound Name | 2-benzyl-1-(2-phenylethyl)-4,5-dihydroimidazole;hydrochloride |
| PubChem CID | 54602889 |
| Molecular Formula | C18H21ClN2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-benzyl-1-(2-phenylethyl)-4,5-dihydroimidazole;hydrochloride |
| SMILES | Cl.c1ccc(CCN2CCN=C2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H20N2.ClH/c1-3-7-16(8-4-1)11-13-20-14-12-19-18(20)15-17-9-5-2-6-10-17;/h1-10H,11-15H2;1H |
| InChIKey | TYIPTENWQHJHGW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-1-(2-phenylethyl)-4,5-dihydroimidazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1-(2-phenylethyl)-4,5-dihydroimidazole;hydrochloride?
The IUPAC name of 2-benzyl-1-(2-phenylethyl)-4,5-dihydroimidazole;hydrochloride (CID 54602889) is 2-benzyl-1-(2-phenylethyl)-4,5-dihydroimidazole;hydrochloride.
What is the SMILES notation for 2-benzyl-1-(2-phenylethyl)-4,5-dihydroimidazole;hydrochloride?
The canonical SMILES for 2-benzyl-1-(2-phenylethyl)-4,5-dihydroimidazole;hydrochloride is Cl.c1ccc(CCN2CCN=C2Cc2ccccc2)cc1.
What is the InChIKey of 2-benzyl-1-(2-phenylethyl)-4,5-dihydroimidazole;hydrochloride?
The InChIKey is TYIPTENWQHJHGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2.ClH/c1-3-7-16(8-4-1)11-13-20-14-12-19-18(20)15-17-9-5-2-6-10-17;/h1-10H,11-15H2;1H.
What are the key properties of 2-benzyl-1-(2-phenylethyl)-4,5-dihydroimidazole;hydrochloride?
2-benzyl-1-(2-phenylethyl)-4,5-dihydroimidazole;hydrochloride has a molecular weight of 300.83 g/mol, XLogP of 3.61, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1-(2-phenylethyl)-4,5-dihydroimidazole;hydrochloride is sourced from PubChem (CID 54602889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).