C5H10O5 — CID 5460291
(2R,3S,4S)-2,3,4,5-tetrahydroxypentanal (PubChem CID 5460291) has the molecular formula C5H10O5 and a molecular weight of 150.13 g/mol. Its IUPAC name is (2R,3S,4S)-2,3,4,5-tetrahydroxypentanal.
| Compound Name | (2R,3S,4S)-2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 5460291 |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | (2R,3S,4S)-2,3,4,5-tetrahydroxypentanal |
| SMILES | O=C[C@H](O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4-,5+/m0/s1 |
| InChIKey | PYMYPHUHKUWMLA-VAYJURFESA-N |
| XLogP | -2.74 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|