C12H18Cl3NO — CID 54603178
[(2Z)-3,7-dimethylocta-2,6-dienyl] 2,2,2-trichloroethanimidate (PubChem CID 54603178) has the molecular formula C12H18Cl3NO and a molecular weight of 298.64 g/mol. Its IUPAC name is [(2Z)-3,7-dimethylocta-2,6-dienyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 54603178 |
| Molecular Formula | C12H18Cl3NO |
| Molecular Weight | 298.64 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OC/C=C(/C)CCC=C(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H18Cl3NO/c1-9(2)5-4-6-10(3)7-8-17-11(16)12(13,14)15/h5,7,16H,4,6,8H2,1-3H3/b10-7-,16-11- |
| InChIKey | RILLNXNDXDGILZ-PGWBGFSZSA-N |
| XLogP | 5.04 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.64 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|