C26H43ClN3O4P — CID 54603282
N-(8-chloro-1,2,3,4-tetrahydroacridin-9-yl)-N',N'-bis(3-methylbutyl)propane-1,3-diamine;phosphoric acid (PubChem CID 54603282) has the molecular formula C26H43ClN3O4P and a molecular weight of 528.07 g/mol. Its IUPAC name is N-(8-chloro-1,2,3,4-tetrahydroacridin-9-yl)-N',N'-bis(3-methylbutyl)propane-1,3-diamine;phosphoric acid.
| Compound Name | N-(8-chloro-1,2,3,4-tetrahydroacridin-9-yl)-N',N'-bis(3-methylbutyl)propane-1,3-diamine;phosphoric acid |
|---|---|
| PubChem CID | 54603282 |
| Molecular Formula | C26H43ClN3O4P |
| Molecular Weight | 528.07 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | N-(8-chloro-1,2,3,4-tetrahydroacridin-9-yl)-N',N'-bis(3-methylbutyl)propane-1,3-diamine;phosphoric acid |
| SMILES | CC(C)CCN(CCCNc1c2c(nc3cccc(Cl)c13)CCCC2)CCC(C)C.O=P(O)(O)O |
| InChI | InChI=1S/C26H40ClN3.H3O4P/c1-19(2)13-17-30(18-14-20(3)4)16-8-15-28-26-21-9-5-6-11-23(21)29-24-12-7-10-22(27)25(24)26;1-5(2,3)4/h7,10,12,19-20H,5-6,8-9,11,13-18H2,1-4H3,(H,28,29);(H3,1,2,3,4) |
| InChIKey | YLKJDPOKTHSGNY-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.07 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|