C34H28N8NaO5+ — CID 54603300
sodium (3Z)-3-[[4-[4-[[2,4-diamino-3-[[4-(carboxymethyl)phenyl]diazenyl]-5-methylphenyl]diazenyl]phenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid (PubChem CID 54603300) has the molecular formula C34H28N8NaO5+ and a molecular weight of 651.64 g/mol. Its IUPAC name is sodium (3Z)-3-[[4-[4-[[2,4-diamino-3-[[4-(carboxymethyl)phenyl]diazenyl]-5-methylphenyl]diazenyl]phenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid.
| Compound Name | sodium (3Z)-3-[[4-[4-[[2,4-diamino-3-[[4-(carboxymethyl)phenyl]diazenyl]-5-methylphenyl]diazenyl]phenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 54603300 |
| Molecular Formula | C34H28N8NaO5+ |
| Molecular Weight | 651.64 g/mol |
| Exact Mass | 651.21 |
| IUPAC Name | sodium (3Z)-3-[[4-[4-[[2,4-diamino-3-[[4-(carboxymethyl)phenyl]diazenyl]-5-methylphenyl]diazenyl]phenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
| SMILES | Cc1cc(/N=N/c2ccc(-c3ccc(N/N=C4/C=CC(=O)C(C(=O)O)=C4)cc3)cc2)c(N)c(/N=N/c2ccc(CC(=O)O)cc2)c1N.[Na+] |
| InChI | InChI=1S/C34H28N8O5.Na/c1-19-16-28(32(36)33(31(19)35)42-39-23-8-2-20(3-9-23)17-30(44)45)41-38-25-12-6-22(7-13-25)21-4-10-24(11-5-21)37-40-26-14-15-29(43)27(18-26)34(46)47;/h2-16,18,37H,17,35-36H2,1H3,(H,44,45)(H,46,47);/q;+1/b40-26-,41-38+,42-39+; |
| InChIKey | QWKDAQYUHMBFPW-UWZVZFCKSA-N |
| XLogP | 4.21 |
| TPSA | 217.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.64 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|