About (9Z,12Z)-octadeca-9,12-dienoate
(9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 5460332) has the molecular formula C18H31O2-
and a molecular weight of 279.44 g/mol. Its IUPAC name is (9Z,12Z)-octadeca-9,12-dienoate.
Molecular Properties
| Compound Name | (9Z,12Z)-octadeca-9,12-dienoate |
| PubChem CID | 5460332 |
| Molecular Formula | C18H31O2- |
| Molecular Weight | 279.44 g/mol |
| Exact Mass | 279.23 |
| IUPAC Name | (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/p-1/b7-6-,10-9- |
| InChIKey | OYHQOLUKZRVURQ-HZJYTTRNSA-M |
| XLogP | 4.55 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (9Z,12Z)-octadeca-9,12-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9Z,12Z)-octadeca-9,12-dienoate?
The IUPAC name of (9Z,12Z)-octadeca-9,12-dienoate (CID 5460332) is (9Z,12Z)-octadeca-9,12-dienoate.
What is the SMILES notation for (9Z,12Z)-octadeca-9,12-dienoate?
The canonical SMILES for (9Z,12Z)-octadeca-9,12-dienoate is CCCCC/C=C\C/C=C\CCCCCCCC(=O)[O-].
What is the InChIKey of (9Z,12Z)-octadeca-9,12-dienoate?
The InChIKey is OYHQOLUKZRVURQ-HZJYTTRNSA-M. The full InChI is InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/p-1/b7-6-,10-9-.
What are the key properties of (9Z,12Z)-octadeca-9,12-dienoate?
(9Z,12Z)-octadeca-9,12-dienoate has a molecular weight of 279.44 g/mol, XLogP of 4.55, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (9Z,12Z)-octadeca-9,12-dienoate is sourced from PubChem (CID 5460332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).