C23H41ClN2O2 — CID 54603452
(3R,5S,8R,9S,10S,13S,14S,17Z)-17-[2-(dimethylamino)ethoxyimino]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol;hydrochloride (PubChem CID 54603452) has the molecular formula C23H41ClN2O2 and a molecular weight of 413.05 g/mol. Its IUPAC name is (3R,5S,8R,9S,10S,13S,14S,17Z)-17-[2-(dimethylamino)ethoxyimino]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol;hydrochloride.
| Compound Name | (3R,5S,8R,9S,10S,13S,14S,17Z)-17-[2-(dimethylamino)ethoxyimino]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol;hydrochloride |
|---|---|
| PubChem CID | 54603452 |
| Molecular Formula | C23H41ClN2O2 |
| Molecular Weight | 413.05 g/mol |
| Exact Mass | 412.29 |
| IUPAC Name | (3R,5S,8R,9S,10S,13S,14S,17Z)-17-[2-(dimethylamino)ethoxyimino]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-ol;hydrochloride |
| SMILES | CN(C)CCO/N=C1/CC[C@H]2[C@@H]3CC[C@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C.Cl |
| InChI | InChI=1S/C23H40N2O2.ClH/c1-22-11-9-17(26)15-16(22)5-6-18-19-7-8-21(24-27-14-13-25(3)4)23(19,2)12-10-20(18)22;/h16-20,26H,5-15H2,1-4H3;1H/b24-21-;/t16-,17+,18-,19-,20-,22-,23-;/m0./s1 |
| InChIKey | IWRGKVPCEWKSON-IMSXQODCSA-N |
| XLogP | 4.75 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.05 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|