2-octadecylguanidine;sulfuric acid

C19H43N3O4S — CID 54603504

IUPAC2-octadecylguanidine;sulfuric acid
SMILESCCCCCCCCCCCCCCCCCCN=C(N)N.O=S(=O)(O)O
InChIInChI=1S/C19H41N3.H2O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-19(20)21;1-5(2,3)4/h2-18H2,1H3,(H4,20,21,22);(H2,1,2,3,4)
InChIKeyCZLXOPXIUDVOME-UHFFFAOYSA-N
MW409.64 g/mol
LogP4.87
Rot. Bonds17

About 2-octadecylguanidine;sulfuric acid

2-octadecylguanidine;sulfuric acid (PubChem CID 54603504) has the molecular formula C19H43N3O4S and a molecular weight of 409.64 g/mol. Its IUPAC name is 2-octadecylguanidine;sulfuric acid.

Molecular Properties

Compound Name2-octadecylguanidine;sulfuric acid
PubChem CID54603504
Molecular FormulaC19H43N3O4S
Molecular Weight409.64 g/mol
Exact Mass409.30
IUPAC Name2-octadecylguanidine;sulfuric acid
SMILESCCCCCCCCCCCCCCCCCCN=C(N)N.O=S(=O)(O)O
InChIInChI=1S/C19H41N3.H2O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-19(20)21;1-5(2,3)4/h2-18H2,1H3,(H4,20,21,22);(H2,1,2,3,4)
InChIKeyCZLXOPXIUDVOME-UHFFFAOYSA-N
XLogP4.87
TPSA139.00 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds17
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500409.64
LogP ≤ 54.87
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-octadecylguanidine;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-octadecylguanidine;sulfuric acid?
The IUPAC name of 2-octadecylguanidine;sulfuric acid (CID 54603504) is 2-octadecylguanidine;sulfuric acid.
What is the SMILES notation for 2-octadecylguanidine;sulfuric acid?
The canonical SMILES for 2-octadecylguanidine;sulfuric acid is CCCCCCCCCCCCCCCCCCN=C(N)N.O=S(=O)(O)O.
What is the InChIKey of 2-octadecylguanidine;sulfuric acid?
The InChIKey is CZLXOPXIUDVOME-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H41N3.H2O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-19(20)21;1-5(2,3)4/h2-18H2,1H3,(H4,20,21,22);(H2,1,2,3,4).
What are the key properties of 2-octadecylguanidine;sulfuric acid?
2-octadecylguanidine;sulfuric acid has a molecular weight of 409.64 g/mol, XLogP of 4.87, 17 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octadecylguanidine;sulfuric acid is sourced from PubChem (CID 54603504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).