About 2-octadecylguanidine;sulfuric acid
2-octadecylguanidine;sulfuric acid (PubChem CID 54603504) has the molecular formula C19H43N3O4S
and a molecular weight of 409.64 g/mol. Its IUPAC name is 2-octadecylguanidine;sulfuric acid.
Molecular Properties
| Compound Name | 2-octadecylguanidine;sulfuric acid |
| PubChem CID | 54603504 |
| Molecular Formula | C19H43N3O4S |
| Molecular Weight | 409.64 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | 2-octadecylguanidine;sulfuric acid |
| SMILES | CCCCCCCCCCCCCCCCCCN=C(N)N.O=S(=O)(O)O |
| InChI | InChI=1S/C19H41N3.H2O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-19(20)21;1-5(2,3)4/h2-18H2,1H3,(H4,20,21,22);(H2,1,2,3,4) |
| InChIKey | CZLXOPXIUDVOME-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.64 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-octadecylguanidine;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octadecylguanidine;sulfuric acid?
The IUPAC name of 2-octadecylguanidine;sulfuric acid (CID 54603504) is 2-octadecylguanidine;sulfuric acid.
What is the SMILES notation for 2-octadecylguanidine;sulfuric acid?
The canonical SMILES for 2-octadecylguanidine;sulfuric acid is CCCCCCCCCCCCCCCCCCN=C(N)N.O=S(=O)(O)O.
What is the InChIKey of 2-octadecylguanidine;sulfuric acid?
The InChIKey is CZLXOPXIUDVOME-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H41N3.H2O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-19(20)21;1-5(2,3)4/h2-18H2,1H3,(H4,20,21,22);(H2,1,2,3,4).
What are the key properties of 2-octadecylguanidine;sulfuric acid?
2-octadecylguanidine;sulfuric acid has a molecular weight of 409.64 g/mol, XLogP of 4.87, 17 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octadecylguanidine;sulfuric acid is sourced from PubChem (CID 54603504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).