About naphthalen-1-ylmethyl N,N'-dioctylcarbamimidothioate;hydrochloride
naphthalen-1-ylmethyl N,N'-dioctylcarbamimidothioate;hydrochloride (PubChem CID 54603590) has the molecular formula C28H45ClN2S
and a molecular weight of 477.20 g/mol. Its IUPAC name is naphthalen-1-ylmethyl N,N'-dioctylcarbamimidothioate;hydrochloride.
Molecular Properties
| Compound Name | naphthalen-1-ylmethyl N,N'-dioctylcarbamimidothioate;hydrochloride |
| PubChem CID | 54603590 |
| Molecular Formula | C28H45ClN2S |
| Molecular Weight | 477.20 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | naphthalen-1-ylmethyl N,N'-dioctylcarbamimidothioate;hydrochloride |
| SMILES | CCCCCCCC/N=C(\NCCCCCCCC)SCc1cccc2ccccc12.Cl |
| InChI | InChI=1S/C28H44N2S.ClH/c1-3-5-7-9-11-15-22-29-28(30-23-16-12-10-8-6-4-2)31-24-26-20-17-19-25-18-13-14-21-27(25)26;/h13-14,17-21H,3-12,15-16,22-24H2,1-2H3,(H,29,30);1H |
| InChIKey | WRTZVQIEXDVSPZ-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.20 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-1-ylmethyl N,N'-dioctylcarbamimidothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-ylmethyl N,N'-dioctylcarbamimidothioate;hydrochloride?
The IUPAC name of naphthalen-1-ylmethyl N,N'-dioctylcarbamimidothioate;hydrochloride (CID 54603590) is naphthalen-1-ylmethyl N,N'-dioctylcarbamimidothioate;hydrochloride.
What is the SMILES notation for naphthalen-1-ylmethyl N,N'-dioctylcarbamimidothioate;hydrochloride?
The canonical SMILES for naphthalen-1-ylmethyl N,N'-dioctylcarbamimidothioate;hydrochloride is CCCCCCCC/N=C(\NCCCCCCCC)SCc1cccc2ccccc12.Cl.
What is the InChIKey of naphthalen-1-ylmethyl N,N'-dioctylcarbamimidothioate;hydrochloride?
The InChIKey is WRTZVQIEXDVSPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H44N2S.ClH/c1-3-5-7-9-11-15-22-29-28(30-23-16-12-10-8-6-4-2)31-24-26-20-17-19-25-18-13-14-21-27(25)26;/h13-14,17-21H,3-12,15-16,22-24H2,1-2H3,(H,29,30);1H.
What are the key properties of naphthalen-1-ylmethyl N,N'-dioctylcarbamimidothioate;hydrochloride?
naphthalen-1-ylmethyl N,N'-dioctylcarbamimidothioate;hydrochloride has a molecular weight of 477.20 g/mol, XLogP of 9.16, 16 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-ylmethyl N,N'-dioctylcarbamimidothioate;hydrochloride is sourced from PubChem (CID 54603590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).