About 4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-amine;hydrochloride
4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-amine;hydrochloride (PubChem CID 54603890) has the molecular formula C13H26ClN
and a molecular weight of 231.81 g/mol. Its IUPAC name is 4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-amine;hydrochloride |
| PubChem CID | 54603890 |
| Molecular Formula | C13H26ClN |
| Molecular Weight | 231.81 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-amine;hydrochloride |
| SMILES | CC1=C(CCC(C)N)C(C)(C)CCC1.Cl |
| InChI | InChI=1S/C13H25N.ClH/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14;/h11H,5-9,14H2,1-4H3;1H |
| InChIKey | KINAOSVHSBRLLX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.81 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-amine;hydrochloride?
The IUPAC name of 4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-amine;hydrochloride (CID 54603890) is 4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-amine;hydrochloride.
What is the SMILES notation for 4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-amine;hydrochloride?
The canonical SMILES for 4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-amine;hydrochloride is CC1=C(CCC(C)N)C(C)(C)CCC1.Cl.
What is the InChIKey of 4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-amine;hydrochloride?
The InChIKey is KINAOSVHSBRLLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N.ClH/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14;/h11H,5-9,14H2,1-4H3;1H.
What are the key properties of 4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-amine;hydrochloride?
4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-amine;hydrochloride has a molecular weight of 231.81 g/mol, XLogP of 4.06, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,6,6-trimethylcyclohexen-1-yl)butan-2-amine;hydrochloride is sourced from PubChem (CID 54603890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).