About Orotic acid, gallium salt (3:2), hemihydrate
Orotic acid, gallium salt (3:2), hemihydrate (PubChem CID 54604023) has the molecular formula C5H3FGaN2O4
and a molecular weight of 243.81 g/mol.
Molecular Properties
| Compound Name | Orotic acid, gallium salt (3:2), hemihydrate |
| PubChem CID | 54604023 |
| Molecular Formula | C5H3FGaN2O4 |
| Molecular Weight | 243.81 g/mol |
| Exact Mass | 242.93 |
| IUPAC Name | — |
| SMILES | O=C(O)c1[nH]c(=O)[nH]c(=O)c1F.[Ga] |
| InChI | InChI=1S/C5H3FN2O4.Ga/c6-1-2(4(10)11)7-5(12)8-3(1)9;/h(H,10,11)(H2,7,8,9,12); |
| InChIKey | MVZFSDXEGHKFCR-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.81 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Orotic acid, gallium salt (3:2), hemihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Orotic acid, gallium salt (3:2), hemihydrate?
The IUPAC name of Orotic acid, gallium salt (3:2), hemihydrate (CID 54604023) is not available.
What is the SMILES notation for Orotic acid, gallium salt (3:2), hemihydrate?
The canonical SMILES for Orotic acid, gallium salt (3:2), hemihydrate is O=C(O)c1[nH]c(=O)[nH]c(=O)c1F.[Ga].
What is the InChIKey of Orotic acid, gallium salt (3:2), hemihydrate?
The InChIKey is MVZFSDXEGHKFCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3FN2O4.Ga/c6-1-2(4(10)11)7-5(12)8-3(1)9;/h(H,10,11)(H2,7,8,9,12);.
What are the key properties of Orotic acid, gallium salt (3:2), hemihydrate?
Orotic acid, gallium salt (3:2), hemihydrate has a molecular weight of 243.81 g/mol, XLogP of -1.48, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Orotic acid, gallium salt (3:2), hemihydrate is sourced from PubChem (CID 54604023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).