C10H21Cl2N2OPt- — CID 54604444
dichloroplatinum;N,N-dimethylformamide;2,4-dimethylpiperidin-1-ide (PubChem CID 54604444) has the molecular formula C10H21Cl2N2OPt- and a molecular weight of 451.28 g/mol. Its IUPAC name is dichloroplatinum;N,N-dimethylformamide;2,4-dimethylpiperidin-1-ide.
| Compound Name | dichloroplatinum;N,N-dimethylformamide;2,4-dimethylpiperidin-1-ide |
|---|---|
| PubChem CID | 54604444 |
| Molecular Formula | C10H21Cl2N2OPt- |
| Molecular Weight | 451.28 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | dichloroplatinum;N,N-dimethylformamide;2,4-dimethylpiperidin-1-ide |
| SMILES | CC1CC[N-]C(C)C1.CN(C)C=O.Cl[Pt]Cl |
| InChI | InChI=1S/C7H14N.C3H7NO.2ClH.Pt/c1-6-3-4-8-7(2)5-6;1-4(2)3-5;;;/h6-7H,3-5H2,1-2H3;3H,1-2H3;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | RYBZPKWKHXMRNK-UHFFFAOYSA-L |
| XLogP | 3.26 |
| TPSA | 34.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|